| Name |
N-[4-(4-amino-7,8-dihydrocyclopenta[4,5]pyrrolo[3,2-d]pyrimidin-5(6h)-yl)phenyl]carbamic acid phenylmethyl ester
|
| Molecular Formula |
C23H21N5O2
|
| Molecular Weight |
399.4
|
| Smiles |
Nc1ncnc2c3c(n(-c4ccc(NC(=O)OCc5ccccc5)cc4)c12)CCC3
|
Nc1ncnc2c3c(n(-c4ccc(NC(=O)OCc5ccccc5)cc4)c12)CCC3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.