| Name |
Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate)
|
| Molecular Formula |
C16H38N2O8P2
|
| Molecular Weight |
448.43
|
| Smiles |
C[N+](C)(C)CCOP(=O)([O-])OCCCCCCOP(=O)([O-])OCC[N+](C)(C)C
|
C[N+](C)(C)CCOP(=O)([O-])OCCCCCCOP(=O)([O-])OCC[N+](C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.