Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate)
Modify Date: 2026-07-18 12:06:53
Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate) structure
|
Common Name | Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate) | ||
|---|---|---|---|---|
| CAS Number | 627459-01-2 | Molecular Weight | 448.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H38N2O8P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H38N2O8P2 |
|---|---|
| Molecular Weight | 448.43 |
| InChIKey | XZPSOPAHULKOKQ-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OCCCCCCOP(=O)([O-])OCC[N+](C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate)? |
| A: InChIKey of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate) is XZPSOPAHULKOKQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate)? |
| A: CAS number of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate) is 627459-01-2. |
| Q: What is the Chinese name of 627459-01-2? |
| A: Chinese name of 627459-01-2 is 627459-01-2. |
| Q: What is the English name of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate)? |
| A: The English name of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate) is Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate). |
| Q: What is the molecular weight of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate)? |
| A: Molecular weight of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate) is 448.43. |
| Q: What is the molecular formula of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate)? |
| A: Molecular formula of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate) is C16H38N2O8P2. |
| Q: What is the SMILES notation of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate)? |
| A: SMILES notation of Hexane-1,6-diyl bis(2-(trimethylammonio)ethyl) bis(phosphate) is C[N+](C)(C)CCOP(=O)([O-])OCCCCCCOP(=O)([O-])OCC[N+](C)(C)C. |