| Name |
1H-Indene-1,3(2H)-dione, 2-(3-methyl-1-oxobutyl)-, ion(1-)
|
| Molecular Formula |
C14H13O3-
|
| Molecular Weight |
229.25
|
| Smiles |
CC(C)CC(=O)C1=C([O-])c2ccccc2C1=O
|
CC(C)CC(=O)C1=C([O-])c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.