| Name |
(1-Cyclopropylethyl)({[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl})amine hydrochloride
|
| Molecular Formula |
C12H17ClN4
|
| Molecular Weight |
252.74
|
| Smiles |
CC(NCc1nnc2ccccn12)C1CC1.Cl
|
CC(NCc1nnc2ccccn12)C1CC1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.