| Name |
(1S,3S,5S,6S)-6-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid hydrochloride
|
| Molecular Formula |
C7H9ClF3NO2
|
| Molecular Weight |
231.60
|
| Smiles |
Cl.O=C(O)C1CC2C(N1)C2C(F)(F)F
|
Cl.O=C(O)C1CC2C(N1)C2C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.