| Name |
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-{3-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]-2-oxo-1,2-dihydropyridin-1-yl}acetamide
|
| Molecular Formula |
C26H26N4O5
|
| Molecular Weight |
474.5
|
| Smiles |
COc1ccc(CCNC(=O)Cn2cccc(-c3nc(-c4ccccc4C)no3)c2=O)cc1OC
|
COc1ccc(CCNC(=O)Cn2cccc(-c3nc(-c4ccccc4C)no3)c2=O)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.