| Name |
2-(4-fluorobenzyl)-8-(3-phenyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one
|
| Molecular Formula |
C21H14FN5O2
|
| Molecular Weight |
387.4
|
| Smiles |
O=c1n(Cc2ccc(F)cc2)nc2c(-c3nc(-c4ccccc4)no3)cccn12
|
O=c1n(Cc2ccc(F)cc2)nc2c(-c3nc(-c4ccccc4)no3)cccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.