| Name |
6-Amino-4-((3,5-dimethylisoxazol-4-yl)methyl)-2H-benzo[b][1,4]oxazin-3(4H)-one
|
| Molecular Formula |
C14H15N3O3
|
| Molecular Weight |
273.29
|
| Smiles |
Cc1noc(C)c1CN1C(=O)COc2ccc(N)cc21
|
Cc1noc(C)c1CN1C(=O)COc2ccc(N)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.