| Name | 1-phenylhexa-2,4-diyn-1-ol |
|---|---|
| Synonyms |
1-Phenyl-hexa-2,4-diin-1-ol
InChI=1/C12H10O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9,12-13H,1H3 Capillinol 1-phenyl-hexa-2,4-diyn-1-ol LRUCYFPADQKETK-UHFFFAOYSA |
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 327.6ºC at 760 mmHg |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.20700 |
| Flash Point | 154.6ºC |
| Exact Mass | 170.07300 |
| PSA | 20.23000 |
| LogP | 1.74670 |
| Vapour Pressure | 8.09E-05mmHg at 25°C |
| Index of Refraction | 1.592 |