| Name | 1-(2-chloropyridin-4-yl)-3-propan-2-ylurea |
|---|---|
| Synonyms |
N-(2-chloro-4-pyridinyl)-N'-(1-methylethyl)urea
Urea,N-(2-chloro-4-pyridinyl)-N'-(1-methylethyl) |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 312.2ºC at 760mmHg |
| Molecular Formula | C9H12ClN3O |
| Molecular Weight | 213.66400 |
| Flash Point | 142.6ºC |
| Exact Mass | 213.06700 |
| PSA | 54.02000 |
| LogP | 2.72880 |
| Vapour Pressure | 0.000536mmHg at 25°C |
| Index of Refraction | 1.577 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |