| Name |
2-(4-{[4-(4-Ethylpiperazin-1-yl)but-2-yn-1-yl]oxy}piperidin-1-yl)-1,3-benzothiazole
|
| Molecular Formula |
C22H30N4OS
|
| Molecular Weight |
398.6
|
| Smiles |
CCN1CCN(CC#CCOC2CCN(c3nc4ccccc4s3)CC2)CC1
|
CCN1CCN(CC#CCOC2CCN(c3nc4ccccc4s3)CC2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.