| Name |
N-{[1-(thiophen-2-yl)-1H-1,2,3-triazol-4-yl]methyl}-4-(trifluoromethyl)pyrimidin-2-amine
|
| Molecular Formula |
C12H9F3N6S
|
| Molecular Weight |
326.30
|
| Smiles |
FC(F)(F)c1ccnc(NCc2cn(-c3cccs3)nn2)n1
|
FC(F)(F)c1ccnc(NCc2cn(-c3cccs3)nn2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.