| Name |
4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine
|
| Molecular Formula |
C11H22Cl6N4O
|
| Molecular Weight |
439.0
|
| Smiles |
CCN(CC)CC.OC1NC(C(Cl)(Cl)Cl)NC(C(Cl)(Cl)Cl)N1
|
CCN(CC)CC.OC1NC(C(Cl)(Cl)Cl)NC(C(Cl)(Cl)Cl)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.