4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine
Modify Date: 2026-07-25 06:59:35
4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine structure
|
Common Name | 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine | ||
|---|---|---|---|---|
| CAS Number | 1823254-01-8 | Molecular Weight | 439.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H22Cl6N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H22Cl6N4O |
|---|---|
| Molecular Weight | 439.0 |
| InChIKey | UTLHUMKSWQBCGB-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.OC1NC(C(Cl)(Cl)Cl)NC(C(Cl)(Cl)Cl)N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine? |
| A: Molecular formula of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine is C11H22Cl6N4O. |
| Q: What is the English name of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine? |
| A: The English name of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine is 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine. |
| Q: What is the SMILES notation of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine? |
| A: SMILES notation of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine is CCN(CC)CC.OC1NC(C(Cl)(Cl)Cl)NC(C(Cl)(Cl)Cl)N1. |
| Q: What is the Chinese name of 1823254-01-8? |
| A: Chinese name of 1823254-01-8 is 1823254-01-8. |
| Q: What is the CAS number of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine? |
| A: CAS number of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine is 1823254-01-8. |
| Q: What is the molecular weight of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine? |
| A: Molecular weight of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine is 439.0. |
| Q: What is the InChIKey of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine? |
| A: InChIKey of 4,6-bis(trichloromethyl)-1,3,5-triazinan-2-ol;N,N-diethylethanamine is UTLHUMKSWQBCGB-UHFFFAOYSA-N. |