| Name |
5-Acetyl-4-bromo-1,3-phenylene bis(dimethylcarbamate)
|
| Molecular Formula |
C14H17BrN2O5
|
| Molecular Weight |
373.20
|
| Smiles |
CC(=O)c1cc(OC(=O)N(C)C)cc(OC(=O)N(C)C)c1Br
|
CC(=O)c1cc(OC(=O)N(C)C)cc(OC(=O)N(C)C)c1Br
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.