| Name | cis-dichloro(2-chlorovinyl) arsine |
|---|---|
| Synonyms |
Dichlor-(cis-2-chlor-vinyl)-arsin
(β-Chlor-vinyl)-arsendichloride dichloro-(cis-2-chloro-vinyl)-arsine dichloro-(2-chloro-vinyl)-arsine α-lewisite |
| Molecular Formula | C2H2AsCl3 |
|---|---|
| Molecular Weight | 207.31800 |
| Exact Mass | 205.84400 |
| LogP | 2.24390 |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 6 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |