| Name | (5-chloro-2-fluorophenyl)boronic acid |
|---|---|
| Synonyms |
5-Chloro-2-fluorophenylboronic acid
MFCD05664225 (5-Chloro-2-fluorophenyl)boronic acid Boronic acid, B-(5-chloro-2-fluorophenyl)- 5-Chloro-2-fluorobenzeneboronic acid |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 310.8±52.0 °C at 760 mmHg |
| Melting Point | 122-127ºC |
| Molecular Formula | C6H5BClFO2 |
| Molecular Weight | 174.365 |
| Flash Point | 141.8±30.7 °C |
| Exact Mass | 174.005508 |
| PSA | 40.46000 |
| LogP | 2.19 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.533 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |