7216-56-0
7216-56-0 structure
- Name: neo-alloocimene, stab.
- Chemical Name: (4E,6Z)-2,6-dimethylocta-2,4,6-triene
- CAS Number: 7216-56-0
- Molecular Formula: C10H16
- Molecular Weight: 136.23400
- Catalog: Flavors and spices Synthetic spice Hydrocarbon spice Olefin
- Create Date: 2018-05-17 08:00:00
- Modify Date: 2026-08-15 11:38:25
| Name | (4E,6Z)-2,6-dimethylocta-2,4,6-triene |
|---|---|
| Synonyms |
trans,cis-2,6-Dimethyl-2,4,6-octatriene
2,4,6-Octatriene,2,6-dimethyl-,(E,Z) triene neo-alloocimene Einecs -6 alloocimene B (E,Z)-alloocimene Allocimene B InChI=1/C10H16/c1-5-10(4)8-6-7-9(2)3/h5-8H,1-4H3/b8-6+,10-5 (E,Z)-2,6-Dimethylocta-2,4,6-triene Allocimene B, trans,cis-2,6-Dimethyl-2,4,6-octatriene 2,4,6-Octatriene, 2,6-dimethyl-, (4E,6Z) 2,6-dimethyl-2,trans-4,cis-6-octatriene (4E,6Z)-alloocimene (E,Z)-2,6-dimethylocta-2,4,6-triene cis-allocimene Allo-ocimene,2,6-dimethyl-2,4,6-octatriene NEO-ALLOOCIMENE, STAB.//BP trans-allo-ocimene 2,6-dimethyloctatriene-2,trans-4,trans-6 neo-alloocimenurum NEO-ALLOOCIMENE, STAB GQVMHMFBVWSSPF-DAIHKBMKSA (4E,6Z)-2,6-Dimethyl-2,4,6-octatriene |
| Density | 0.811 g/mL at 20ºC(lit.) |
|---|---|
| Boiling Point | 196-198ºC |
| Melting Point | -20.6°C |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.23400 |
| Flash Point | 38ºC |
| Exact Mass | 136.12500 |
| LogP | 3.47500 |
| Index of Refraction | n20/D 1.546 |
| Storage condition | 2-8°C |
| Risk Phrases | R10 |
|---|---|
| RIDADR | UN 1993 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
