| Name | 3-chloro-N-(4-fluorophenyl)propanamide |
|---|---|
| Synonyms |
Cinnamic acid,4-methoxy-,cis
EINECS 227-137-0 F9995-0371 (2Z)-3-(4-methoxyphenyl)prop-2-enoic acid (2Z)-3-(4-Methoxyphenyl)acrylic acid (Z)-p-Methoxycinnamic acid N-(4-Fluorophenyl)-3-chloropropanamide Propanamide,N-(4-fluorophenyl)-3-chloro (Z)-3-(4-Methoxyphenyl)acrylic acid 2-Propenoic acid,3-(4-methoxyphenyl)-,(2Z) |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 342.6±17.0 °C at 760 mmHg |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.185 |
| Flash Point | 138.6±14.4 °C |
| Exact Mass | 178.062988 |
| PSA | 29.10000 |
| LogP | 2.36 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.591 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |