INT-767 structure
|
Common Name | INT-767 | ||
|---|---|---|---|---|
| CAS Number | 1000403-03-1 | Molecular Weight | 494.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H43NaO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of INT-767INT-767 is a dual farnesoid X receptor/TGR5 agonist with mean EC50s of 30 and 630 nM, respectively. |
| Name | INT-767 |
|---|
| Description | INT-767 is a dual farnesoid X receptor/TGR5 agonist with mean EC50s of 30 and 630 nM, respectively. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H43NaO6S |
|---|---|
| Molecular Weight | 494.66 |
| InChIKey | TXIWHUPIUUZFFK-PMWRKVJASA-M |
| SMILES | CCC1C(O)C2C3CCC(C(C)CCOS(=O)(=O)[O-])C3(C)CCC2C2(C)CCC(O)CC12.[Na+] |
| Storage condition | 2-8℃ |