1-Benzenesulfonyl-5-fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine structure
|
Common Name | 1-Benzenesulfonyl-5-fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 1001413-99-5 | Molecular Weight | 402.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8FIN2O2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-Benzenesulfonyl-5-fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8FIN2O2S |
|---|---|
| Molecular Weight | 402.18300 |
| Exact Mass | 401.93400 |
| PSA | 60.34000 |
| LogP | 4.09780 |
| InChIKey | KUIWDKYKFUDNNA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)n1cc(I)c2cc(F)cnc21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(benzenesulfonyl)-5-fluoro-3-iodopyrrolo[2,3-b]pyridine |