4'-Chloro-2-fluoro-N-(2-hydroxyethyl)acetanilide structure
|
Common Name | 4'-Chloro-2-fluoro-N-(2-hydroxyethyl)acetanilide | ||
|---|---|---|---|---|
| CAS Number | 10016-08-7 | Molecular Weight | 231.65100 | |
| Density | 1.343g/cm3 | Boiling Point | 373.7ºC at 760mmHg | |
| Molecular Formula | C10H11ClFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.8ºC | |
| Name | N-(4-chlorophenyl)-2-fluoro-N-(2-hydroxyethyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 373.7ºC at 760mmHg |
| Molecular Formula | C10H11ClFNO2 |
| Molecular Weight | 231.65100 |
| Flash Point | 179.8ºC |
| Exact Mass | 231.04600 |
| PSA | 40.54000 |
| LogP | 1.63480 |
| Vapour Pressure | 3E-06mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | FVVZKGZPIKCOPH-UHFFFAOYSA-N |
| SMILES | O=C(CF)N(CCO)c1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ACETANILIDE,4'-CHLORO-2-FLUORO-N-(2-HYDROXYETHYL) |
| 4'-Chloro-2-fluoro-N-(2-hydroxyethyl)acetanilide |