2-Fluoro-N-(2-hydroxyethyl)-N-(1-naphtyl)acetamide structure
|
Common Name | 2-Fluoro-N-(2-hydroxyethyl)-N-(1-naphtyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 10016-11-2 | Molecular Weight | 247.26500 | |
| Density | 1.27g/cm3 | Boiling Point | 423.4ºC at 760 mmHg | |
| Molecular Formula | C14H14FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.9ºC | |
| Name | 2-fluoro-N-(2-hydroxyethyl)-N-naphthalen-1-ylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 423.4ºC at 760 mmHg |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.26500 |
| Flash Point | 209.9ºC |
| Exact Mass | 247.10100 |
| PSA | 40.54000 |
| LogP | 2.13460 |
| Vapour Pressure | 6.32E-08mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | SRHCIXDVBODFMP-UHFFFAOYSA-N |
| SMILES | O=C(CF)N(CCO)c1cccc2ccccc12 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ACETAMIDE,2-FLUORO-N-(2-HYDROXYETHYL)-N-1-NAPHTHYL |
| LS-9621 |
| 2-Fluoro-N-(2-hydroxyethyl)-N-1-naphthylacetamide |
| 2-fluoro-N-(2-hydroxyethyl)-N-(naphthalen-1-yl)acetamide |