2-Fluoro-N-methyl-4'-nitroacetanilide structure
|
Common Name | 2-Fluoro-N-methyl-4'-nitroacetanilide | ||
|---|---|---|---|---|
| CAS Number | 10016-09-8 | Molecular Weight | 212.17800 | |
| Density | 1.34g/cm3 | Boiling Point | 352.6ºC at 760mmHg | |
| Molecular Formula | C9H9FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.1ºC | |
| Name | 2-fluoro-N-methyl-N-(4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 352.6ºC at 760mmHg |
| Molecular Formula | C9H9FN2O3 |
| Molecular Weight | 212.17800 |
| Flash Point | 167.1ºC |
| Exact Mass | 212.06000 |
| PSA | 66.13000 |
| LogP | 2.05030 |
| Vapour Pressure | 3.79E-05mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | IKWVBWXAHHTTCR-UHFFFAOYSA-N |
| SMILES | CN(C(=O)CF)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ACETANILIDE,2-FLUORO-N-METHYL-4'-NITRO |
| 2-Fluoro-N-methyl-4'-nitroacetanilide |