2-Fluoro-N-methyl-2',4',5'-trichloroacetanilide structure
|
Common Name | 2-Fluoro-N-methyl-2',4',5'-trichloroacetanilide | ||
|---|---|---|---|---|
| CAS Number | 10015-99-3 | Molecular Weight | 270.51500 | |
| Density | 1.483g/cm3 | Boiling Point | 383.4ºC at 760mmHg | |
| Molecular Formula | C9H7Cl3FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.7ºC | |
| Name | 2-fluoro-N-methyl-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.483g/cm3 |
|---|---|
| Boiling Point | 383.4ºC at 760mmHg |
| Molecular Formula | C9H7Cl3FNO |
| Molecular Weight | 270.51500 |
| Flash Point | 185.7ºC |
| Exact Mass | 268.95800 |
| PSA | 20.31000 |
| LogP | 3.57910 |
| Vapour Pressure | 4.41E-06mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | DVNXDHROJIFEFM-UHFFFAOYSA-N |
| SMILES | CN(C(=O)CF)c1cc(Cl)c(Cl)cc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ACETANILIDE,2-FLUORO-N-METHYL-2',4',5'-TRICHLORO |
| 2-Fluoro-N-methyl-2',4',5'-trichloroacetanilide |