N-Ethyl-2-fluoro-2',4',5'-trichloroacetanilide structure
|
Common Name | N-Ethyl-2-fluoro-2',4',5'-trichloroacetanilide | ||
|---|---|---|---|---|
| CAS Number | 10016-10-1 | Molecular Weight | 284.54200 | |
| Density | 1.43g/cm3 | Boiling Point | 394.1ºC at 760mmHg | |
| Molecular Formula | C10H9Cl3FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.1ºC | |
| Name | N-ethyl-2-fluoro-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 394.1ºC at 760mmHg |
| Molecular Formula | C10H9Cl3FNO |
| Molecular Weight | 284.54200 |
| Flash Point | 192.1ºC |
| Exact Mass | 282.97300 |
| PSA | 20.31000 |
| LogP | 3.96920 |
| Vapour Pressure | 2.04E-06mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | RJOQPFZKWBSZBQ-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)CF)c1cc(Cl)c(Cl)cc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Ethyl-2-fluoro-2',4',5'-trichloroacetanilide |
| ACETANILIDE,N-ETHYL-2-FLUORO-2',4',5'-TRICHLORO |