2-Fluoro-2',4',5'-trichloroacetanilide structure
|
Common Name | 2-Fluoro-2',4',5'-trichloroacetanilide | ||
|---|---|---|---|---|
| CAS Number | 23595-40-6 | Molecular Weight | 256.48900 | |
| Density | 1.565g/cm3 | Boiling Point | 384.1ºC at 760mmHg | |
| Molecular Formula | C8H5Cl3FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.1ºC | |
| Name | 2-fluoro-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.565g/cm3 |
|---|---|
| Boiling Point | 384.1ºC at 760mmHg |
| Molecular Formula | C8H5Cl3FNO |
| Molecular Weight | 256.48900 |
| Flash Point | 186.1ºC |
| Exact Mass | 254.94200 |
| PSA | 32.59000 |
| LogP | 4.20430 |
| Vapour Pressure | 4.18E-06mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | YVJPREDLAWMTFC-UHFFFAOYSA-N |
| SMILES | O=C(CF)Nc1cc(Cl)c(Cl)cc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Fluoro-2',4',5'-trichloroacetanilide |
| ACETANILIDE,2-FLUORO-2',4',5'-TRICHLORO |