tert-butyl 3-(hydrazinecarbonyl)azetidine-1-carboxylate structure
|
Common Name | tert-butyl 3-(hydrazinecarbonyl)azetidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1001907-44-3 | Molecular Weight | 215.250 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 382.5±31.0 °C at 760 mmHg | |
| Molecular Formula | C9H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.1±24.8 °C | |
| Name | tert-butyl 3-(hydrazinecarbonyl)azetidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.5±31.0 °C at 760 mmHg |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.250 |
| Flash Point | 185.1±24.8 °C |
| Exact Mass | 215.126984 |
| PSA | 84.66000 |
| LogP | -1.09 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | IOXCKRNGHYJOAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(=O)NN)C1 |
| HS Code | 2933990090 |
|---|
|
~%
tert-butyl 3-(h... CAS#:1001907-44-3 |
| Literature: WO2010/91808 A1, ; Page/Page column 151-152 ; WO 2010/091808 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-hydrazinocarbonyl-azetidine-1-carboxylic acid tert-butyl ester |
| tert-butyl 3-(hydrazinylcarbonyl)azetidine-1-carboxylate |
| 2-Methyl-2-propanyl 3-(hydrazinocarbonyl)-1-azetidinecarboxylate |
| 1-BOC-3-HYDRAZINOCARBONYL-AZETIDINE |