1-Boc-azetidine-3-carboxylic acid structure
|
Common Name | 1-Boc-azetidine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 142253-55-2 | Molecular Weight | 201.220 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 321.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H15NO4 | Melting Point | 100.1-101.9°C | |
| MSDS | Chinese USA | Flash Point | 147.9±25.9 °C | |
Use of 1-Boc-azetidine-3-carboxylic acid1-Boc-azetidine-3-carboxylic acid is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). 1-Boc-azetidine-3-carboxylic acid is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1][2] |
| Name | 1-Boc-3-Azetidine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 1-Boc-azetidine-3-carboxylic acid is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). 1-Boc-azetidine-3-carboxylic acid is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1][2] |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 321.0±35.0 °C at 760 mmHg |
| Melting Point | 100.1-101.9°C |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.220 |
| Flash Point | 147.9±25.9 °C |
| Exact Mass | 201.100113 |
| PSA | 66.84000 |
| LogP | 0.27 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | NCADHSLPNSTDMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(=O)O)C1 |
| Storage condition | Store at -15°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S22-S24/25-S37-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~97%
1-Boc-azetidine... CAS#:142253-55-2 |
| Literature: AstraZeneca AB Patent: US2008/171732 A1, 2008 ; Location in patent: Page/Page column 36 ; US 20080171732 A1 |
|
~58%
1-Boc-azetidine... CAS#:142253-55-2 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH; COGAN, Derek; MOSS, Neil; SARKO, Christopher Ronald; BAMFORD, Samantha Jayne; LOKE, Pui Leng; NAPIER, Spencer Charles, R.; TYE, Heather; WHITTAKER, Mark Patent: WO2010/80357 A1, 2010 ; Location in patent: Page/Page column 45 ; WO 2010/080357 A1 |
|
~81%
1-Boc-azetidine... CAS#:142253-55-2 |
| Literature: PFIZER LIMITED; ACIRO, Caroline; BAGAL, Sharanjeet Kaur; HARVEY, John Wilson; JONES, Lyn Howard; MOWBRAY, Charles Eric; OWEN, Robert McKenzie; SABNIS, Yogesh Anil; STORER, Robert Ian; YEAP, Siew Kuen Patent: WO2010/131145 A1, 2010 ; Location in patent: Page/Page column 86 ; |
|
~%
1-Boc-azetidine... CAS#:142253-55-2 |
| Literature: US5977178 A1, ; |
|
~%
1-Boc-azetidine... CAS#:142253-55-2 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 12, # 5 p. 757 - 761 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-azetidinecarboxylic acid |
| 1-N-Boc-3-Azetidinecarboxylic Acid |
| 1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
| MFCD01860897 |
| 1-(tert-Butoxycarbonyl)azetidine-3-carboxylic Acid |
| N-Boc-Azetidine-3-carboxylic acid |
| 1-BOC-Azetidine-3-carboxylic acid |
| 1-Boc-azetidine-3-carboxylicacid |