piscidinol a structure
|
Common Name | piscidinol a | ||
|---|---|---|---|---|
| CAS Number | 100198-09-2 | Molecular Weight | 474.72 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 599.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H50O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.3±26.6 °C | |
Use of piscidinol aPiscidinol A is a compound isolated from Aphanamixis polystachyawith potential anticancer activity[1]. |
| Name | (13α,14β,17α,20S,23R,24S)-23,24,25-Trihydroxylanost-7-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Piscidinol A is a compound isolated from Aphanamixis polystachyawith potential anticancer activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 599.4±50.0 °C at 760 mmHg |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.72 |
| Flash Point | 330.3±26.6 °C |
| Exact Mass | 474.370911 |
| PSA | 77.76000 |
| LogP | 5.81 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | DCGUKHULKAAOPB-QBLSGNHRSA-N |
| SMILES | CC(CC(O)C(O)C(C)(C)O)C1CCC2(C)C3=CCC4C(C)(C)C(=O)CCC4(C)C3CCC12C |
| Hazard Codes | Xi |
|---|
| Pyruvicacid phenylhydrazone |
| 2-Phenylhydrazono-propionsaeure |
| 2-phenylhydrazono-propionic acid |
| Brenztraubensaeure-phenylhydrazon |
| piscidinol A |
| (13α,14β,17α,20S,23R,24S)-23,24,25-Trihydroxylanost-7-en-3-one |
| 3-oxo-threo-23,24,25-trihydroxytirucall-7-ene |
| Lanost-7-en-3-one, 23,24,25-trihydroxy-, (13α,14β,17α,20S,23R,24S)- |
| piruvic acid phenylhydrazone |
| pyruvate phenylhydrazone |