1-Phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole structure
|
Common Name | 1-Phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 1002334-12-4 | Molecular Weight | 270.135 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 389.8±15.0 °C at 760 mmHg | |
| Molecular Formula | C15H19BN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.6±20.4 °C | |
| Name | 1-Phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.8±15.0 °C at 760 mmHg |
| Molecular Formula | C15H19BN2O2 |
| Molecular Weight | 270.135 |
| Flash Point | 189.6±20.4 °C |
| Exact Mass | 270.153961 |
| PSA | 36.28000 |
| LogP | 2.17150 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | XPAJFLOIPDXRRD-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cnn(-c3ccccc3)c2)OC1(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
|
~46%
1-Phenyl-4-(4,4... CAS#:1002334-12-4 |
| Literature: Journal of the American Chemical Society, , vol. 131, p. 7762 - 7769 |
|
~50%
1-Phenyl-4-(4,4... CAS#:1002334-12-4 |
| Literature: PROGENICS PHARMACEUTICALS, INC. Patent: WO2009/155527 A2, 2009 ; Location in patent: Page/Page column 134 ; WO 2009/155527 A2 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| 1-Phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| 1H-Pyrazole, 1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- |