cis-1,2-Cyclohexanediamine dihydrochloride structure
|
Common Name | cis-1,2-Cyclohexanediamine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 10027-80-2 | Molecular Weight | 187.11 | |
| Density | 0.939g/cm3 | Boiling Point | 193.6ºC at 760mmHg | |
| Molecular Formula | C6H16Cl2N2 | Melting Point | 307-310 °C | |
| MSDS | N/A | Flash Point | 75ºC | |
| Name | (1R,2S)-Cyclohexane-1,2-diamine dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 0.939g/cm3 |
|---|---|
| Boiling Point | 193.6ºC at 760mmHg |
| Melting Point | 307-310 °C |
| Molecular Formula | C6H16Cl2N2 |
| Molecular Weight | 187.11 |
| Flash Point | 75ºC |
| Exact Mass | 186.0690539 |
| PSA | 52.04000 |
| LogP | 2.41760 |
| InChIKey | HEKOZXSZLOBKGM-RUTFAPCESA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)N)N.Cl.Cl |
| HS Code | 2921300090 |
|---|
|
~82%
cis-1,2-Cyclohe... CAS#:10027-80-2 |
| Literature: UNIVERSITY OF NEWCASTLE UPON TYNE Patent: WO2008/132474 A1, 2008 ; Location in patent: Page/Page column 30 ; |
|
~99%
cis-1,2-Cyclohe... CAS#:10027-80-2 |
| Literature: Alfonso, Ignacio; Rebolledo, Francisca; Gotor, Vicente Tetrahedron Asymmetry, 1999 , vol. 10, # 2 p. 367 - 374 |
| HS Code | 2921300090 |
|---|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (1R,2S)-cyclohexane-1,2-diamine,dihydrochloride |