(1R,2R)-N,N'-Di-p-tosyl-1,2-cyclohexanediamine structure
|
Common Name | (1R,2R)-N,N'-Di-p-tosyl-1,2-cyclohexanediamine | ||
|---|---|---|---|---|
| CAS Number | 143585-47-1 | Molecular Weight | 422.56100 | |
| Density | 1.33 g/cm3 | Boiling Point | 591.4ºC at 760 mmHg | |
| Molecular Formula | C20H26N2O4S2 | Melting Point | 170-173ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 311.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-methyl-N-[(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33 g/cm3 |
|---|---|
| Boiling Point | 591.4ºC at 760 mmHg |
| Melting Point | 170-173ºC(lit.) |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.56100 |
| Flash Point | 311.5ºC |
| Exact Mass | 422.13300 |
| PSA | 109.10000 |
| LogP | 5.81480 |
| Vapour Pressure | 5.85E-14mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | FIAAGQKYVFEMGC-WOJBJXKFSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCCCC2NS(=O)(=O)c2ccc(C)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
|
~81%
(1R,2R)-N,N'-Di... CAS#:143585-47-1 |
| Literature: Gerlach, Uwe; Haubenreich, Thomas; Huenig, Siegfried Chemische Berichte, 1994 , vol. 127, # 10 p. 1969 - 1980 |
|
~90%
(1R,2R)-N,N'-Di... CAS#:143585-47-1 |
| Literature: Alfonso, Ignacio; Rebolledo, Francisca; Gotor, Vicente Tetrahedron Asymmetry, 1999 , vol. 10, # 2 p. 367 - 374 |
|
~%
(1R,2R)-N,N'-Di... CAS#:143585-47-1 |
| Literature: Angewandte Chemie, , vol. 108, # 4 p. 449 - 452 |
|
~%
(1R,2R)-N,N'-Di... CAS#:143585-47-1 |
| Literature: Angewandte Chemie, , vol. 108, # 4 p. 449 - 452 |
|
~%
(1R,2R)-N,N'-Di... CAS#:143585-47-1 |
| Literature: Angewandte Chemie, , vol. 108, # 4 p. 449 - 452 |
|
~%
(1R,2R)-N,N'-Di... CAS#:143585-47-1 |
| Literature: Tetrahedron Asymmetry, , vol. 10, # 2 p. 367 - 374 |
|
~%
(1R,2R)-N,N'-Di... CAS#:143585-47-1 |
| Literature: Angewandte Chemie, , vol. 108, # 4 p. 449 - 452 |
| N-{(1R,2R)-2-[(p-toluenesulfonyl)amino]cyclohexyl}-p-tolunesulfonamide |
| trans-(R,R)-N,N'-Bis(tolylsulfonyl)-1,2-cyclohexandiamin |
| (R,R)-N,N'-(cyclohexane-1,2-diyl)bis(p-toluenesulphonamide) |
| (1R,2R)-1,2-N,N'-bis(p-toluenesulfonylamino)cyclohexane |
| (1R,2R)-1,2-N,N'-Bis[(4-toluenesulfonyl)amino]cyclohexane |
| res(R,R)-trans-1,2-bis(p-toluenyl-sulfonamide)cyclohexane |
| MFCD01321377 |
| (1R,2R)-4-methyl-N-(2-{[(4-methylphenyl)sulfonyl]amino}cyclohexyl)benzenesulfonamide |
| (R,R)-N,N'-bis(p-tolylsulfonyl)-trans-cyclohexane-1,2-diamine |
| (1R,2R)-(+)-N,N inverted exclamation marka-Di-p-tosyl-1,2-cyclohexanediamine |
| (1R,2R)-(+)-N,N'-Di-p-tosyl-1,2-cyclohexanediamine |