8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline
8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline structure
|
Common Name | 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline | ||
|---|---|---|---|---|
| CAS Number | 100331-89-3 | Molecular Weight | 372.213 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 596.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H14BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.5±28.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 596.4±45.0 °C at 760 mmHg |
| Molecular Formula | C18H14BrNO3 |
| Molecular Weight | 372.213 |
| Flash Point | 314.5±28.7 °C |
| Exact Mass | 371.015686 |
| PSA | 59.42000 |
| LogP | 3.48 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | RVHSDLUBNZBRMH-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| HS Code | 2942000000 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~76%
8-Benzyloxy-5-(... CAS#:100331-89-3 |
| Literature: Tanabe Seiyaku Co., Ltd. Patent: US4579854 A1, 1986 ; |
|
~%
8-Benzyloxy-5-(... CAS#:100331-89-3 |
| Literature: US2012/46467 A1, ; |
|
~%
8-Benzyloxy-5-(... CAS#:100331-89-3 |
| Literature: US2012/46467 A1, ; |
|
~%
8-Benzyloxy-5-(... CAS#:100331-89-3 |
| Literature: US2012/46467 A1, ; |
|
~%
8-Benzyloxy-5-(... CAS#:100331-89-3 |
| Literature: US2012/46467 A1, ; |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 8-(Benzyloxy)-5-(bromoacetyl)quinolin-2(1H)-one |
| 1-[8-(Benzyloxy)-2-hydroxyquinolin-5-yl]-2-bromoethanone |
| 1-(8-(Benzyloxy)-2-hydroxyquinolin-5-yl)-2-bromoethanone |
| 8-(Benzyloxy)-5-(bromoacetyl)-2(1H)-quinolinone |
| 5-(2-bromoacetyl)-8-phenylmethoxy-1H-quinolin-2-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline? |
| A: SMILES notation of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline is O=C(CBr)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12. |
| Q: What is the polar surface area (PSA) of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline? |
| A: Polar surface area (PSA) of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline is 59.42000. |
| Q: What is the English name of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline? |
| A: The English name of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline is 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline. |
| Q: What is the InChIKey of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline? |
| A: InChIKey of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline is RVHSDLUBNZBRMH-UHFFFAOYSA-N. |
| Q: What is the boiling point of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline? |
| A: Boiling point of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline is 596.4±45.0 °C at 760 mmHg. |
| Q: What is the LogP of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline? |
| A: LogP of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline is 3.48. |
| Q: What is the CAS number of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline? |
| A: CAS number of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline is 100331-89-3. |
| Q: What is the molecular weight of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline? |
| A: Molecular weight of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline is 372.213. |
| Q: What English synonyms does 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline have? |
| A: English synonyms of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline: 8-(Benzyloxy)-5-(bromoacetyl)quinolin-2(1H)-one, 1-[8-(Benzyloxy)-2-hydroxyquinolin-5-yl]-2-bromoethanone, 1-(8-(Benzyloxy)-2-hydroxyquinolin-5-yl)-2-bromoethanone, 8-(Benzyloxy)-5-(bromoacetyl)-2(1H)-quinolinone, 5-(2-bromoacetyl)-8-phenylmethoxy-1H-quinolin-2-one. |
| Q: What is the molecular formula of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline? |
| A: Molecular formula of 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline is C18H14BrNO3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |