2,4-Difluoro-3,5-dimethoxybenzoic acid
Modify Date: 2025-09-14 13:32:15
2,4-Difluoro-3,5-dimethoxybenzoic acid structure
|
Common Name | 2,4-Difluoro-3,5-dimethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1003709-80-5 | Molecular Weight | 218.154 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 363.5±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H8F2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.6±26.5 °C | |
| Name | 2,4-Difluoro-3,5-dimethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 363.5±37.0 °C at 760 mmHg |
| Molecular Formula | C9H8F2O4 |
| Molecular Weight | 218.154 |
| Flash Point | 173.6±26.5 °C |
| Exact Mass | 218.039063 |
| PSA | 55.76000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | LLRUPRYHYIFLJS-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)c(F)c(OC)c1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid, 2,4-difluoro-3,5-dimethoxy- |
| 2,4-Difluoro-3,5-dimethoxybenzoic acid |