4-chlorobenzalhydantoin structure
|
Common Name | 4-chlorobenzalhydantoin | ||
|---|---|---|---|---|
| CAS Number | 10040-86-5 | Molecular Weight | 222.62800 | |
| Density | 1.45g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chlorobenzalhydantoin |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Molecular Formula | C10H7ClN2O2 |
| Molecular Weight | 222.62800 |
| Exact Mass | 222.02000 |
| PSA | 58.20000 |
| LogP | 2.17790 |
| Index of Refraction | 1.654 |
| InChIKey | NXSHAXRMBPQCIM-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(=Cc2ccc(Cl)cc2)N1 |
|
~93%
4-chlorobenzalh... CAS#:10040-86-5 |
| Literature: Synthetic Communications, , vol. 36, # 11 p. 1575 - 1584 |
|
~%
4-chlorobenzalh... CAS#:10040-86-5 |
| Literature: Tetrahedron, , vol. 67, # 45 p. 8639 - 8647 |
|
~68%
4-chlorobenzalh... CAS#:10040-86-5 |
| Literature: Synthetic Communications, , vol. 22, # 1 p. 145 - 150 |
|
~%
4-chlorobenzalh... CAS#:10040-86-5 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , p. 2045 - 2050 |