1,2,3,4,5,6-hexaethynylbenzene
Modify Date: 2024-01-03 16:26:32
1,2,3,4,5,6-hexaethynylbenzene structure
|
Common Name | 1,2,3,4,5,6-hexaethynylbenzene | ||
|---|---|---|---|---|
| CAS Number | 100516-61-8 | Molecular Weight | 222.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3,4,5,6-hexaethynylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H6 |
|---|---|
| Molecular Weight | 222.24000 |
| Exact Mass | 222.04700 |
| LogP | 1.57440 |
|
~97%
1,2,3,4,5,6-hex... CAS#:100516-61-8 |
| Literature: Diercks, Rainer; Armstrong, James C.; Boese, Roland; Vollhardt, K. Peter C. Angewandte Chemie, 1986 , vol. 98, # 3 p. 270 - 271 |
|
~%
1,2,3,4,5,6-hex... CAS#:100516-61-8 |
| Literature: Dierks,R.; Vollhardt,K.P. Journal of the American Chemical Society, 1986 , vol. 108, p. 3150 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Hexaethinbenzol |
| benzene,hexaethynyl |
| hexaethynylbenzene |
| InChI=1/C18H6/c1-7-13-14(8-2)16(10-4)18(12-6)17(11-5)15(13)9-3/h1-6 |