Methyl 4-(1-aminocyclopropyl)benzoate structure
|
Common Name | Methyl 4-(1-aminocyclopropyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 1006037-03-1 | Molecular Weight | 191.226 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 297.5±33.0 °C at 760 mmHg | |
| Molecular Formula | C11H13NO2 | Melting Point | 49.6-50.4 °C | |
| MSDS | N/A | Flash Point | 153.5±22.9 °C | |
| Name | Methyl 4-(1-aminocyclopropyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 297.5±33.0 °C at 760 mmHg |
| Melting Point | 49.6-50.4 °C |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.226 |
| Flash Point | 153.5±22.9 °C |
| Exact Mass | 191.094635 |
| PSA | 52.32000 |
| LogP | 1.34 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | JUMQWXLIAYMPHT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C2(N)CC2)cc1 |
| Hazard Codes | Xi |
|---|
|
~44%
Methyl 4-(1-ami... CAS#:1006037-03-1 |
| Literature: MERCK and CO., INC.; MERCK FROSST CANADA LTD. Patent: WO2009/20588 A1, 2009 ; Location in patent: Page/Page column 13-14 ; WO 2009/020588 A1 |
|
~99%
Methyl 4-(1-ami... CAS#:1006037-03-1 |
| Literature: Gauvreau, Danny; Dolman, Sarah J.; Hughes, Greg; Oshea, Paul D.; Davies, Ian W. Journal of Organic Chemistry, 2010 , vol. 75, # 12 p. 4078 - 4085 |
| 1-(4-METHOXY-PHENYL)-CYCLOPROPYLAMINE |
| Methyl 4-(1-aminocyclopropyl)benzoate |
| Benzoic acid, 4-(1-aminocyclopropyl)-, methyl ester |
| 4-(1-Aminocyclopropyl)anisole |
| 1-(4-METHOXYPHENYL)CYCLOPROPANAMINE |
| 4-(1-amino-cyclopropyl)-benzoic acid methyl ester |
| 1-[4-(methoxycarbonyl)phenyl]cyclopropanamine |
| methyl 4-(1-amino-cyclopropyl)-benzoate |