2-amino-6-chloro-5-nitropyrimidin-4-ol structure
|
Common Name | 2-amino-6-chloro-5-nitropyrimidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 1007-99-4 | Molecular Weight | 190.545 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | 268.2ºC at 760 mmHg | |
| Molecular Formula | C4H3ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116ºC | |
| Name | 2-Amino-4-chloro-6-hydroxy-5-nitropyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 268.2ºC at 760 mmHg |
| Molecular Formula | C4H3ClN4O3 |
| Molecular Weight | 190.545 |
| Flash Point | 116ºC |
| Exact Mass | 189.989365 |
| PSA | 117.85000 |
| LogP | -1.29 |
| Vapour Pressure | 1.67E-06mmHg at 25°C |
| Index of Refraction | 1.816 |
| InChIKey | UTTPUMOOQSNOHH-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cl)c([N+](=O)[O-])c(=O)[nH]1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~95%
2-amino-6-chlor... CAS#:1007-99-4 |
| Literature: Burgdorf, Lars T; Carell, Thomas Chemistry (Weinheim an der Bergstrasse, Germany), 2002 , vol. 8, # 1 p. 293 - 301 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-amino-6-chloro-5-nitropyrimidin-4-ol |
| MFCD07367841 |
| 2-amino-4-chloro-6-hydroxy-5-nitropyrimidine |
| 2-Amino-6-chloro-5-nitro-4(1H)-pyrimidinone |
| 2-Amino-6-chloro-5-nitropyrimidin-4(3H)-one |