1-(benzenesulfonyl)but-3-enylsulfonylbenzene structure
|
Common Name | 1-(benzenesulfonyl)but-3-enylsulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 100780-24-3 | Molecular Weight | 336.42600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(benzenesulfonyl)but-3-enylsulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16O4S2 |
|---|---|
| Molecular Weight | 336.42600 |
| Exact Mass | 336.04900 |
| PSA | 85.04000 |
| LogP | 4.99800 |
| InChIKey | GFOCBTRDQSQPQO-UHFFFAOYSA-N |
| SMILES | C=CCC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
|
~%
1-(benzenesulfo... CAS#:100780-24-3 |
| Literature: Journal of the American Chemical Society, , vol. 117, # 27 p. 7071 - 7080 |
|
~%
1-(benzenesulfo... CAS#:100780-24-3 |
| Literature: Tetrahedron, , vol. 42, # 17 p. 4807 - 4816 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| allylbis(phenylsulfonyl)methane |
| 1,1-bisbenzenesulfonyl-3-butene |
| Benzene,1,1'-[3-butenylidenebis(sulfonyl)]bis |