Bis(phenylsulfonyl)methane structure
|
Common Name | Bis(phenylsulfonyl)methane | ||
|---|---|---|---|---|
| CAS Number | 3406-02-8 | Molecular Weight | 296.362 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 552.8±46.0 °C at 760 mmHg | |
| Molecular Formula | C13H12O4S2 | Melting Point | 119-121 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 374.4±21.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | bis(phenylsulfonyl)methane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 552.8±46.0 °C at 760 mmHg |
| Melting Point | 119-121 °C(lit.) |
| Molecular Formula | C13H12O4S2 |
| Molecular Weight | 296.362 |
| Flash Point | 374.4±21.7 °C |
| Exact Mass | 296.017700 |
| PSA | 85.04000 |
| LogP | 1.67 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | QCHNSJNRFSOCLJ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(CS(=O)(=O)c1ccccc1)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2904100000 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
K. Burgess
Tetrahedron Lett. 26 , 3049, (1985)
|
|
|
A.F. Cunningham, E.P. Kündig
Tetrahedron Lett. 53 , 1823, (1988)
|
|
|
B.M. Trost, J.I. Luengo
J. Am. Chem. Soc. 110 , 8239, (1988)
|
| Benzene, 1,1'-(methylenedisulfonyl)bis- |
| 1,1'-(Methylenedisulfonyl)dibenzene |
| bis-phenylsulfonyl methane |
| Benzene, 1,1'-[methylenebis(sulfonyl)]bis- |
| BIS(PHENYLSULPHONYL)METHANE |
| Di(phenylsulfonyl)methane |
| 1-{[(phenylsulfonyl)methyl]sulfonyl}benzene |
| EINECS 222-291-5 |
| (Methylenebis(sulphonyl))bisbenzene |
| Bis-(phenylsulfonyl)-methan |
| CH2(SO2Ph)2 |
| Bis(Phenylsulfonyl)Methane |
| (PhSO2)2CH2 |
| (Methylenedisulfonyl)dibenzene |
| Bis(benzenesulfonyl)methane |
| bis(phenylsulfonyl)methaneyl-1,3-butadiene |
| METHYLENEBIS(PHENYL SULFONE) |
| MFCD00007553 |