N-(4-methoxy-2-methylquinolin-6-yl)acetamide structure
|
Common Name | N-(4-methoxy-2-methylquinolin-6-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 100795-23-1 | Molecular Weight | 230.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-methoxy-2-methylquinolin-6-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14N2O2 |
|---|---|
| Molecular Weight | 230.26200 |
| Exact Mass | 230.10600 |
| PSA | 51.22000 |
| LogP | 2.58320 |
| InChIKey | QEJJTUPQGGEUFD-UHFFFAOYSA-N |
| SMILES | COc1cc(C)nc2ccc(NC(C)=O)cc12 |
| HS Code | 2933499090 |
|---|
|
~82%
N-(4-methoxy-2-... CAS#:100795-23-1 |
| Literature: Zheng, Yi; Nassar, Nicolas; Skowronek, Karlheinz R. Patent: US2007/155766 A1, 2007 ; Location in patent: Page/Page column 28 ; |
|
~%
N-(4-methoxy-2-... CAS#:100795-23-1 |
| Literature: Pratt; Archer Journal of the American Chemical Society, 1948 , vol. 70, p. 4065,4069 |
|
~%
N-(4-methoxy-2-... CAS#:100795-23-1 |
| Literature: Shinkai; Ito; Iida; Kitao; Yamada; Uchida Journal of Medicinal Chemistry, 2000 , vol. 43, # 24 p. 4667 - 4677 |
|
~%
N-(4-methoxy-2-... CAS#:100795-23-1 |
| Literature: Jacini Gazzetta Chimica Italiana, 1941 , vol. 71, p. 53,57 |
|
~%
N-(4-methoxy-2-... CAS#:100795-23-1 |
| Literature: Jacini Gazzetta Chimica Italiana, 1941 , vol. 71, p. 53,57 |
| Precursor 6 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(4-methoxy-2-methyl-[6]quinolyl)-acetamide |
| 6-acetamide-4-methoxy-2-methylquinoline |
| N-(4-Methoxy-2-methyl-[6]chinolyl)-acetamid |
| Acetamide,N-(4-methoxy-2-methyl-6-quinolinyl) |
| 6-acetamido-4-methoxyquinaldine |
| 6-acetamido-4-methoxy-2-methylquinoline |