Acetamide,2-chloro-N-9H-purin-6-yl- structure
|
Common Name | Acetamide,2-chloro-N-9H-purin-6-yl- | ||
|---|---|---|---|---|
| CAS Number | 10082-95-8 | Molecular Weight | 211.60800 | |
| Density | 1.78g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H6ClN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-N-(7H-purin-6-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.78g/cm3 |
|---|---|
| Molecular Formula | C7H6ClN5O |
| Molecular Weight | 211.60800 |
| Exact Mass | 211.02600 |
| PSA | 83.56000 |
| LogP | 0.60320 |
| Index of Refraction | 1.795 |
| InChIKey | KLZFMCBADSEGSF-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ncnc2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
|
~%
Acetamide,2-chl... CAS#:10082-95-8 |
| Literature: Craveri; Zoni Chimica, 1958 , vol. 34, p. 407,412 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N6-Chloroacetyladenine |
| Acetamide,2-chloro-N-1H-purin-6-yl |