KCNQ1 activator-1 structure
|
Common Name | KCNQ1 activator-1 | ||
|---|---|---|---|---|
| CAS Number | 1008671-38-2 | Molecular Weight | 457.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23N3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.4±37.0 °C(Predicted) | |
Use of KCNQ1 activator-1KCNQ1 activator-1 (compound 3) is a potent activator of KCNQ1 channel. KCNQ1 activator-1 has the potential for the research of long QT syndrome (LQTS)[1]. |
| Name | KCNQ1 activator-1 |
|---|
| Description | KCNQ1 activator-1 (compound 3) is a potent activator of KCNQ1 channel. KCNQ1 activator-1 has the potential for the research of long QT syndrome (LQTS)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H23N3O4S2 |
|---|---|
| Molecular Weight | 457.57 |
| Flash Point | 312.4±37.0 °C(Predicted) |
| InChIKey | UUTYPVHYRISWDI-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2csc(NC(=O)C3CCCCN3S(=O)(=O)c3ccccc3)n2)cc1 |