2-[(E)-(4-phenoxyphenyl)methylideneamino]guanidine structure
|
Common Name | 2-[(E)-(4-phenoxyphenyl)methylideneamino]guanidine | ||
|---|---|---|---|---|
| CAS Number | 100871-36-1 | Molecular Weight | 254.28700 | |
| Density | 1.2g/cm3 | Boiling Point | 438.4ºC at 760mmHg | |
| Molecular Formula | C14H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.9ºC | |
| Name | 2-[(E)-(4-phenoxyphenyl)methylideneamino]guanidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 438.4ºC at 760mmHg |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.28700 |
| Flash Point | 218.9ºC |
| Exact Mass | 254.11700 |
| PSA | 83.49000 |
| LogP | 3.48680 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | UYGCZCDFUWVUHR-LICLKQGHSA-N |
| SMILES | NC(N)=NN=Cc1ccc(Oc2ccccc2)cc1 |
|
~%
2-[(E)-(4-pheno... CAS#:100871-36-1 |
| Literature: Cavallini,G. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1961 , vol. 4, p. 177 - 182 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Hydrazinecarboximidamide,2-((4-phenoxyphenyl)methylene) |
| (4-Phenoxy-benzylidenamino)-guanidin |
| 2-((4-(Phenoxy)phenyl)methylideneamino)guanidine |
| Guanidine,(p-phenoxybenzylideneamino) |