5'-O-DMT-N4-Ac-dC structure
|
Common Name | 5'-O-DMT-N4-Ac-dC | ||
|---|---|---|---|---|
| CAS Number | 100898-63-3 | Molecular Weight | 571.62000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H33N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-O-DMT-N4-Ac-dC5'-O-DMT-N4-Ac-dC (N4-Acetyl-2'-deoxy-5'-O-DMT-cytidine, compound 7), a deoxynucleoside, can be used to synthesize of dodecyl phosphoramidite which is the raw material for dod‐DNA (amphiphilic DNA containing an internal hydrophobic region consisting of dodecyl phosphotriester linkages) synthesis[1][2]. |
| Name | 5'-o-(4,4'-dimethoxytrityl)-n4-acetyl-2'-deoxycytidine |
|---|---|
| Synonym | More Synonyms |
| Description | 5'-O-DMT-N4-Ac-dC (N4-Acetyl-2'-deoxy-5'-O-DMT-cytidine, compound 7), a deoxynucleoside, can be used to synthesize of dodecyl phosphoramidite which is the raw material for dod‐DNA (amphiphilic DNA containing an internal hydrophobic region consisting of dodecyl phosphotriester linkages) synthesis[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C32H33N3O7 |
|---|---|
| Molecular Weight | 571.62000 |
| Exact Mass | 571.23200 |
| PSA | 121.14000 |
| LogP | 3.94900 |
| InChIKey | FHZQVUQHQIUSPM-PKZQBKLLSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3ccc(NC(C)=O)nc3=O)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Storage condition | Store dry at 2-8°C |
|
~%
5'-O-DMT-N4-Ac-dC CAS#:100898-63-3 |
| Literature: Nucleosides and Nucleotides, , vol. 16, # 7-9 p. 1589 - 1598 |
|
~86%
5'-O-DMT-N4-Ac-dC CAS#:100898-63-3 |
| Literature: Reddy; Hanna, Naeem B.; Farooqui, Firdous Nucleosides and Nucleotides, 1997 , vol. 16, # 7-9 p. 1589 - 1598 |
| DMT-NAC-DC |
| N4-Acetyl-2'-Deoxy-5'-O-Dmt-D-Cytidine |
| N-ACETYL-5'-O-[BIS(4-METHOXYPHENYL)-PHENYLMETHYL]-2'-DEOXY-CYTIDINE |
| DMT-Ac-dC |
| N-ACETYL-5'-O-[BIS(4-METHOXYPHENYL)PHENYLMETHYL]-2'-DEOXY-CYTIDINE |
| N4-ACETYL-2'-DEOXY-5'-O-DMT-CYTIDINE |
| N-Acetyl-5'-O-(4,4'-dimethoxytrityl)-2'-deoxycytidine |
| 5'-O-(4,4'-Dimethoxytrityl)-N4-acetyl-2'-deoxycytidine |
| 5'-O-dimethoxytrityl-4-N-acetyl-2'-deoxycytidine |
| DMT-N4-Ac-dC |
| N4-Acetyl-2'-deoxy-5'-O-DMT-D-cytidine |
| 5'-DMTr-N4-acetyl-2'-deoxycytidine |
| N4-Acetyl-2'-deoxy-5'-O-DMT-cytidine |
| N4-ACETYL-2'-DEOXY-5'-O-[BIS(4-METHOXYPHENYL)PHENYLMETHYL]-CYTIDINE |
| 5'-DMT-N4-Ac-dC |