L-Proline 4-methoxy-β-naphthylamide hydrochloride structure
|
Common Name | L-Proline 4-methoxy-β-naphthylamide hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 100930-07-2 | Molecular Weight | 306.78700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-Proline 4-methoxy-β-naphthylamide hydrochlorideL-Proline 4-methoxy-β-naphthylamide hydrochloride (H-Pro-4MβNA hydrochloride) can be used for Fap-activated anti-tumor compounds preparaction[1]. |
| Name | (2S)-N-(4-methoxynaphthalen-2-yl)pyrrolidine-2-carboxamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | L-Proline 4-methoxy-β-naphthylamide hydrochloride (H-Pro-4MβNA hydrochloride) can be used for Fap-activated anti-tumor compounds preparaction[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. John Edward Park, et al. Fap-activated anti-tumor compounds. Patent WO2000071571A2. |
| Molecular Formula | C16H19ClN2O2 |
|---|---|
| Molecular Weight | 306.78700 |
| Exact Mass | 306.11400 |
| PSA | 50.36000 |
| LogP | 3.74270 |
| InChIKey | DKLGYZDYMFOBFD-UQKRIMTDSA-N |
| SMILES | COc1cc(NC(=O)C2CCCN2)cc2ccccc12.Cl |
| Storage condition | -15°C |
| L-Proline 4-methoxy-|A-naphthylamide hydrochloride |