4-amino-5-[[2-[[1-[(4-methoxynaphthalen-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid structure
|
Common Name | 4-amino-5-[[2-[[1-[(4-methoxynaphthalen-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 100940-58-7 | Molecular Weight | 506.55000 | |
| Density | 1.318g/cm3 | Boiling Point | 923.5ºC at 760 mmHg | |
| Molecular Formula | C27H30N4O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 512.3ºC | |
| Symbol |
GHS08 |
Signal Word | Warning | |
| Name | 4-amino-5-[[2-[[1-[(4-methoxynaphthalen-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 923.5ºC at 760 mmHg |
| Molecular Formula | C27H30N4O6 |
| Molecular Weight | 506.55000 |
| Flash Point | 512.3ºC |
| Exact Mass | 506.21700 |
| PSA | 170.32000 |
| LogP | 4.85310 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | PBDYNZJYYRZOFV-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)C(Cc2ccccc2)NC(=O)CNC(=O)C(N)CCC(=O)O)cc2ccccc12 |
| Symbol |
GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H351 |
| Precautionary Statements | P281 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 40 |
| Safety Phrases | 22-36 |
| RIDADR | NONH for all modes of transport |
| N-Glutaryl-Gly-Phe-4-methoxy-|A-naphthylamide |