4,5-Dihydro-2-[(3,4,5-trimethoxyphenyl)methyl]-1H-imidazole structure
|
Common Name | 4,5-Dihydro-2-[(3,4,5-trimethoxyphenyl)methyl]-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 101-30-4 | Molecular Weight | 250.29400 | |
| Density | 1.18g/cm3 | Boiling Point | 426.1ºC at 760mmHg | |
| Molecular Formula | C13H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.5ºC | |
| Name | 2-[(3,4,5-trimethoxyphenyl)methyl]-4,5-dihydro-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 426.1ºC at 760mmHg |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.29400 |
| Flash Point | 211.5ºC |
| Exact Mass | 250.13200 |
| PSA | 52.08000 |
| LogP | 1.02100 |
| Vapour Pressure | 4.51E-07mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | XJNCXQWJMJWBEJ-UHFFFAOYSA-N |
| SMILES | COc1cc(CC2=NCCN2)cc(OC)c1OC |
| HS Code | 2933290090 |
|---|
|
~%
4,5-Dihydro-2-[... CAS#:101-30-4 |
| Literature: CIBA Patent: DE687196 , 1938 ; DRP/DRBP Org.Chem. |
|
~%
4,5-Dihydro-2-[... CAS#:101-30-4 |
| Literature: CIBA Patent: US2505247 , 1946 ; Full Text Show Details CIBA Patent: DE842063 , 1951 ; DRP/DRBP Org.Chem. |
|
~%
4,5-Dihydro-2-[... CAS#:101-30-4 |
| Literature: CIBA Patent: US2161938 , 1938 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ciba 2020 |
| Phedrazin [German] |
| Phedracin |
| 2-IMIDAZOLINE,2-(3,4,5-TRIMETHOXYBENZYL) |
| Phedracine |
| Phedrazine |
| 2-(3',4',5'-Trimethoxybenzyl)imidazoline |
| 2-(3,4,5-trimethoxy-benzyl)-4,5-dihydro-1H-imidazole |
| Phedrazin |